C23H37N9O5 — CID 145150694
(2S)-2-[[(1S)-5-amino-1-[3-[(1S)-1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamoylamino]-6-(diaminomethylideneamino)hexanoic acid (PubChem CID 145150694) has the molecular formula C23H37N9O5 and a molecular weight of 519.61 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-amino-1-[3-[(1S)-1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamoylamino]-6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | (2S)-2-[[(1S)-5-amino-1-[3-[(1S)-1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamoylamino]-6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 145150694 |
| Molecular Formula | C23H37N9O5 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | (2S)-2-[[(1S)-5-amino-1-[3-[(1S)-1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamoylamino]-6-(diaminomethylideneamino)hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)N[C@@H](CCCCN=C(N)N)C(=O)O)c1nc([C@@H](N)Cc2ccc(O)cc2)no1 |
| InChI | InChI=1S/C23H37N9O5/c24-11-3-1-5-17(29-23(36)30-18(21(34)35)6-2-4-12-28-22(26)27)20-31-19(32-37-20)16(25)13-14-7-9-15(33)10-8-14/h7-10,16-18,33H,1-6,11-13,24-25H2,(H,34,35)(H4,26,27,28)(H2,29,30,36)/t16-,17-,18-/m0/s1 |
| InChIKey | GAGDPQNELPSZLD-BZSNNMDCSA-N |
| XLogP | 0.38 |
| TPSA | 254.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|