C22H32N8O6 — CID 146600506
(2S)-2-[[(1S)-1-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-carboxypropyl]carbamoylamino]-4-phenylbutanoic acid (PubChem CID 146600506) has the molecular formula C22H32N8O6 and a molecular weight of 504.55 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-carboxypropyl]carbamoylamino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[[(1S)-1-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-carboxypropyl]carbamoylamino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 146600506 |
| Molecular Formula | C22H32N8O6 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | (2S)-2-[[(1S)-1-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-carboxypropyl]carbamoylamino]-4-phenylbutanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)c1noc([C@H](CCC(=O)O)NC(=O)N[C@@H](CCc2ccccc2)C(=O)O)n1 |
| InChI | InChI=1S/C22H32N8O6/c23-14(7-4-12-26-21(24)25)18-29-19(36-30-18)15(10-11-17(31)32)27-22(35)28-16(20(33)34)9-8-13-5-2-1-3-6-13/h1-3,5-6,14-16H,4,7-12,23H2,(H,31,32)(H,33,34)(H4,24,25,26)(H2,27,28,35)/t14-,15-,16-/m0/s1 |
| InChIKey | BBIVTMZKGKYZLG-JYJNAYRXSA-N |
| XLogP | 0.41 |
| TPSA | 245.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|