C18H32N8O6 — CID 139322080
2-[[(1S)-1-[3-[(1S)-1-amino-3-carboxypropyl]-1,2,4-oxadiazol-5-yl]-4-(diaminomethylideneamino)butyl]carbamoylamino]-3-methylpentanoic acid (PubChem CID 139322080) has the molecular formula C18H32N8O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[[(1S)-1-[3-[(1S)-1-amino-3-carboxypropyl]-1,2,4-oxadiazol-5-yl]-4-(diaminomethylideneamino)butyl]carbamoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[[(1S)-1-[3-[(1S)-1-amino-3-carboxypropyl]-1,2,4-oxadiazol-5-yl]-4-(diaminomethylideneamino)butyl]carbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 139322080 |
| Molecular Formula | C18H32N8O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[[(1S)-1-[3-[(1S)-1-amino-3-carboxypropyl]-1,2,4-oxadiazol-5-yl]-4-(diaminomethylideneamino)butyl]carbamoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)N[C@@H](CCCN=C(N)N)c1nc([C@@H](N)CCC(=O)O)no1)C(=O)O |
| InChI | InChI=1S/C18H32N8O6/c1-3-9(2)13(16(29)30)24-18(31)23-11(5-4-8-22-17(20)21)15-25-14(26-32-15)10(19)6-7-12(27)28/h9-11,13H,3-8,19H2,1-2H3,(H,27,28)(H,29,30)(H4,20,21,22)(H2,23,24,31)/t9?,10-,11-,13?/m0/s1 |
| InChIKey | MFTHJVHKFKHJBD-ZRZGDYATSA-N |
| XLogP | -0.17 |
| TPSA | 245.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|