C16H28N8O6 — CID 147707973
(3S)-3-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-[[(3S)-2-hydroxy-4-oxopentan-3-yl]carbamoylamino]propanoic acid (PubChem CID 147707973) has the molecular formula C16H28N8O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is (3S)-3-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-[[(3S)-2-hydroxy-4-oxopentan-3-yl]carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-[[(3S)-2-hydroxy-4-oxopentan-3-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 147707973 |
| Molecular Formula | C16H28N8O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (3S)-3-[3-[(1S)-1-amino-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-5-yl]-3-[[(3S)-2-hydroxy-4-oxopentan-3-yl]carbamoylamino]propanoic acid |
| SMILES | CC(=O)[C@@H](NC(=O)N[C@@H](CC(=O)O)c1nc([C@@H](N)CCCN=C(N)N)no1)C(C)O |
| InChI | InChI=1S/C16H28N8O6/c1-7(25)12(8(2)26)22-16(29)21-10(6-11(27)28)14-23-13(24-30-14)9(17)4-3-5-20-15(18)19/h7,9-10,12,25H,3-6,17H2,1-2H3,(H,27,28)(H4,18,19,20)(H2,21,22,29)/t7?,9-,10-,12-/m0/s1 |
| InChIKey | GUDNYHFGAKXOQI-BSNDYIFGSA-N |
| XLogP | -1.72 |
| TPSA | 245.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|