C13H21N7O3 — CID 134111399
1-[5-[(1R)-1-acetamido-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-3-yl]cyclopropane-1-carboxamide (PubChem CID 134111399) has the molecular formula C13H21N7O3 and a molecular weight of 323.36 g/mol. Its IUPAC name is 1-[5-[(1R)-1-acetamido-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-[5-[(1R)-1-acetamido-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134111399 |
| Molecular Formula | C13H21N7O3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-[5-[(1R)-1-acetamido-4-(diaminomethylideneamino)butyl]-1,2,4-oxadiazol-3-yl]cyclopropane-1-carboxamide |
| SMILES | CC(=O)N[C@H](CCCN=C(N)N)c1nc(C2(C(N)=O)CC2)no1 |
| InChI | InChI=1S/C13H21N7O3/c1-7(21)18-8(3-2-6-17-12(15)16)9-19-11(20-23-9)13(4-5-13)10(14)22/h8H,2-6H2,1H3,(H2,14,22)(H,18,21)(H4,15,16,17)/t8-/m1/s1 |
| InChIKey | RLEVQHIPMJIFBO-MRVPVSSYSA-N |
| XLogP | -1.18 |
| TPSA | 175.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|