C20H32N4O3 — CID 138689070
[(1S)-1-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(dimethylamino)pentyl]carbamic acid (PubChem CID 138689070) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1S)-1-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(dimethylamino)pentyl]carbamic acid.
| Compound Name | [(1S)-1-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(dimethylamino)pentyl]carbamic acid |
|---|---|
| PubChem CID | 138689070 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | [(1S)-1-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(dimethylamino)pentyl]carbamic acid |
| SMILES | CN(C)CCCC[C@H](NC(=O)O)c1nc(C23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C20H32N4O3/c1-24(2)6-4-3-5-16(21-19(25)26)17-22-18(23-27-17)20-10-13-7-14(11-20)9-15(8-13)12-20/h13-16,21H,3-12H2,1-2H3,(H,25,26)/t13?,14?,15?,16-,20?/m0/s1 |
| InChIKey | TYALKTXYTUFCME-OCABNYQQSA-N |
| XLogP | 3.58 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|