C14H24N6O6 — CID 145151020
2-[[5-(1,5-diaminopentyl)-1,3,4-oxadiazol-2-yl]methylcarbamoylamino]pentanedioic acid (PubChem CID 145151020) has the molecular formula C14H24N6O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-[[5-(1,5-diaminopentyl)-1,3,4-oxadiazol-2-yl]methylcarbamoylamino]pentanedioic acid.
| Compound Name | 2-[[5-(1,5-diaminopentyl)-1,3,4-oxadiazol-2-yl]methylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 145151020 |
| Molecular Formula | C14H24N6O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[[5-(1,5-diaminopentyl)-1,3,4-oxadiazol-2-yl]methylcarbamoylamino]pentanedioic acid |
| SMILES | NCCCCC(N)c1nnc(CNC(=O)NC(CCC(=O)O)C(=O)O)o1 |
| InChI | InChI=1S/C14H24N6O6/c15-6-2-1-3-8(16)12-20-19-10(26-12)7-17-14(25)18-9(13(23)24)4-5-11(21)22/h8-9H,1-7,15-16H2,(H,21,22)(H,23,24)(H2,17,18,25) |
| InChIKey | VCOBQOCXDYGYDJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 206.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|