C14H19Cl2N3O3 — CID 69109772
(2S)-6-amino-2-[(3,4-dichlorophenyl)methylcarbamoylamino]hexanoic acid (PubChem CID 69109772) has the molecular formula C14H19Cl2N3O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is (2S)-6-amino-2-[(3,4-dichlorophenyl)methylcarbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(3,4-dichlorophenyl)methylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 69109772 |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (2S)-6-amino-2-[(3,4-dichlorophenyl)methylcarbamoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)NCc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H19Cl2N3O3/c15-10-5-4-9(7-11(10)16)8-18-14(22)19-12(13(20)21)3-1-2-6-17/h4-5,7,12H,1-3,6,8,17H2,(H,20,21)(H2,18,19,22)/t12-/m0/s1 |
| InChIKey | VGZMZUVCBSUAKE-LBPRGKRZSA-N |
| XLogP | 2.37 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|