C19H24O4S — CID 145154035
(2E,4E,6E,8E)-8-[(6S)-2,6-dimethyl-7,7-dioxo-7λ6-thiabicyclo[4.2.0]oct-1-en-8-ylidene]-3,7-dimethylocta-2,4,6-trienoic acid (PubChem CID 145154035) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is (2E,4E,6E,8E)-8-[(6S)-2,6-dimethyl-7,7-dioxo-7λ6-thiabicyclo[4.2.0]oct-1-en-8-ylidene]-3,7-dimethylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E,8E)-8-[(6S)-2,6-dimethyl-7,7-dioxo-7λ6-thiabicyclo[4.2.0]oct-1-en-8-ylidene]-3,7-dimethylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 145154035 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2E,4E,6E,8E)-8-[(6S)-2,6-dimethyl-7,7-dioxo-7λ6-thiabicyclo[4.2.0]oct-1-en-8-ylidene]-3,7-dimethylocta-2,4,6-trienoic acid |
| SMILES | CC1=C2/C(=C\C(C)=C\C=C\C(C)=C\C(=O)O)S(=O)(=O)[C@@]2(C)CCC1 |
| InChI | InChI=1S/C19H24O4S/c1-13(7-5-8-14(2)12-17(20)21)11-16-18-15(3)9-6-10-19(18,4)24(16,22)23/h5,7-8,11-12H,6,9-10H2,1-4H3,(H,20,21)/b8-5+,13-7+,14-12+,16-11+/t19-/m0/s1 |
| InChIKey | MQBFMUXJTXJYFG-YLLPWLQESA-N |
| XLogP | 4.09 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|