C30H55Cl — CID 145154080
chloromethane;ethane;(3R)-13-ethyl-3-methyl-17-[(2R)-5-methylhex-5-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene (PubChem CID 145154080) has the molecular formula C30H55Cl and a molecular weight of 451.22 g/mol. Its IUPAC name is chloromethane;ethane;(3R)-13-ethyl-3-methyl-17-[(2R)-5-methylhex-5-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene.
| Compound Name | chloromethane;ethane;(3R)-13-ethyl-3-methyl-17-[(2R)-5-methylhex-5-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 145154080 |
| Molecular Formula | C30H55Cl |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 450.40 |
| IUPAC Name | chloromethane;ethane;(3R)-13-ethyl-3-methyl-17-[(2R)-5-methylhex-5-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
| SMILES | C=C(C)CC[C@@H](C)C1CCC2C3CCC4C[C@H](C)CCC4C3CCC21CC.CC.CCl |
| InChI | InChI=1S/C27H46.C2H6.CH3Cl/c1-6-27-16-15-23-22-11-8-19(4)17-21(22)10-12-24(23)26(27)14-13-25(27)20(5)9-7-18(2)3;2*1-2/h19-26H,2,6-17H2,1,3-5H3;1-2H3;1H3/t19-,20-,21?,22?,23?,24?,25?,26?,27?;;/m1../s1 |
| InChIKey | KXWGLBXGZWGDNC-JOTRVKHMSA-N |
| XLogP | 10.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|