C10H18O3 — CID 145154661
ethane;2,2,5,6-tetramethyl-1,3-dioxin-4-one (PubChem CID 145154661) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is ethane;2,2,5,6-tetramethyl-1,3-dioxin-4-one.
| Compound Name | ethane;2,2,5,6-tetramethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 145154661 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | ethane;2,2,5,6-tetramethyl-1,3-dioxin-4-one |
| SMILES | CC.CC1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C8H12O3.C2H6/c1-5-6(2)10-8(3,4)11-7(5)9;1-2/h1-4H3;1-2H3 |
| InChIKey | BBIRPTOPCANZPT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |