C31H31F3O5 — CID 145154816
dibenzyl 2-[3-oxo-2-[4-(trifluoromethyl)phenyl]cyclopentyl]propanedioate;ethane (PubChem CID 145154816) has the molecular formula C31H31F3O5 and a molecular weight of 540.58 g/mol. Its IUPAC name is dibenzyl 2-[3-oxo-2-[4-(trifluoromethyl)phenyl]cyclopentyl]propanedioate;ethane.
| Compound Name | dibenzyl 2-[3-oxo-2-[4-(trifluoromethyl)phenyl]cyclopentyl]propanedioate;ethane |
|---|---|
| PubChem CID | 145154816 |
| Molecular Formula | C31H31F3O5 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | dibenzyl 2-[3-oxo-2-[4-(trifluoromethyl)phenyl]cyclopentyl]propanedioate;ethane |
| SMILES | CC.O=C(OCc1ccccc1)C(C(=O)OCc1ccccc1)C1CCC(=O)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H25F3O5.C2H6/c30-29(31,32)22-13-11-21(12-14-22)25-23(15-16-24(25)33)26(27(34)36-17-19-7-3-1-4-8-19)28(35)37-18-20-9-5-2-6-10-20;1-2/h1-14,23,25-26H,15-18H2;1-2H3 |
| InChIKey | AESYAXRHPJUHEN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|