C39H52N2 — CID 145157303
ethane;2-ethynyl-N-methyl-N-[(2-methylphenyl)methyl]aniline;N-[3-(4-prop-1-en-2-ylphenyl)pentyl]hexa-1,5-dien-2-amine (PubChem CID 145157303) has the molecular formula C39H52N2 and a molecular weight of 548.86 g/mol. Its IUPAC name is ethane;2-ethynyl-N-methyl-N-[(2-methylphenyl)methyl]aniline;N-[3-(4-prop-1-en-2-ylphenyl)pentyl]hexa-1,5-dien-2-amine.
| Compound Name | ethane;2-ethynyl-N-methyl-N-[(2-methylphenyl)methyl]aniline;N-[3-(4-prop-1-en-2-ylphenyl)pentyl]hexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 145157303 |
| Molecular Formula | C39H52N2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | ethane;2-ethynyl-N-methyl-N-[(2-methylphenyl)methyl]aniline;N-[3-(4-prop-1-en-2-ylphenyl)pentyl]hexa-1,5-dien-2-amine |
| SMILES | C#Cc1ccccc1N(C)Cc1ccccc1C.C=CCCC(=C)NCCC(CC)c1ccc(C(=C)C)cc1.CC |
| InChI | InChI=1S/C20H29N.C17H17N.C2H6/c1-6-8-9-17(5)21-15-14-18(7-2)20-12-10-19(11-13-20)16(3)4;1-4-15-10-7-8-12-17(15)18(3)13-16-11-6-5-9-14(16)2;1-2/h6,10-13,18,21H,1,3,5,7-9,14-15H2,2,4H3;1,5-12H,13H2,2-3H3;1-2H3 |
| InChIKey | DTSXBYNAKQWFFJ-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|