About 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane
4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane (PubChem CID 145157389) has the molecular formula C14H14BrNO3
and a molecular weight of 324.17 g/mol. Its IUPAC name is 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane.
Molecular Properties
| Compound Name | 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane |
| PubChem CID | 145157389 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane |
| SMILES | C.O=C(O)c1nccc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C13H10BrNO3.CH4/c14-10-6-7-15-11(13(16)17)12(10)18-8-9-4-2-1-3-5-9;/h1-7H,8H2,(H,16,17);1H4 |
| InChIKey | SAVMHSCKOZSGOX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane?
The IUPAC name of 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane (CID 145157389) is 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane.
What is the SMILES notation for 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane?
The canonical SMILES for 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane is C.O=C(O)c1nccc(Br)c1OCc1ccccc1.
What is the InChIKey of 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane?
The InChIKey is SAVMHSCKOZSGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrNO3.CH4/c14-10-6-7-15-11(13(16)17)12(10)18-8-9-4-2-1-3-5-9;/h1-7H,8H2,(H,16,17);1H4.
What are the key properties of 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane?
4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane has a molecular weight of 324.17 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-phenylmethoxypyridine-2-carboxylic acid;methane is sourced from PubChem (CID 145157389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).