C47H37N — CID 145158280
N-[1-(3,5-diphenylphenyl)ethenyl]-1-spiro[1,2-dihydrofluorene-9,9'-6,7-dihydrofluorene]-2'-ylethanimine (PubChem CID 145158280) has the molecular formula C47H37N and a molecular weight of 615.82 g/mol. Its IUPAC name is N-[1-(3,5-diphenylphenyl)ethenyl]-1-spiro[1,2-dihydrofluorene-9,9'-6,7-dihydrofluorene]-2'-ylethanimine.
| Compound Name | N-[1-(3,5-diphenylphenyl)ethenyl]-1-spiro[1,2-dihydrofluorene-9,9'-6,7-dihydrofluorene]-2'-ylethanimine |
|---|---|
| PubChem CID | 145158280 |
| Molecular Formula | C47H37N |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N-[1-(3,5-diphenylphenyl)ethenyl]-1-spiro[1,2-dihydrofluorene-9,9'-6,7-dihydrofluorene]-2'-ylethanimine |
| SMILES | C=C(/N=C(\C)c1ccc2c(c1)C1(C3=CCCC=C32)C2=C(C=CCC2)c2ccccc21)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C47H37N/c1-31(48-32(2)36-27-37(33-15-5-3-6-16-33)29-38(28-36)34-17-7-4-8-18-34)35-25-26-42-41-21-11-14-24-45(41)47(46(42)30-35)43-22-12-9-19-39(43)40-20-10-13-23-44(40)47/h3-10,12,15-22,24-30H,2,11,13-14,23H2,1H3/b48-31+ |
| InChIKey | HTGXZOJBLFWATN-GKOACKCWSA-N |
| XLogP | 12.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|