C19H21NO3 — CID 145160496
ethane;(2,5,7-trimethylquinolin-8-yl) furan-2-carboxylate (PubChem CID 145160496) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is ethane;(2,5,7-trimethylquinolin-8-yl) furan-2-carboxylate.
| Compound Name | ethane;(2,5,7-trimethylquinolin-8-yl) furan-2-carboxylate |
|---|---|
| PubChem CID | 145160496 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | ethane;(2,5,7-trimethylquinolin-8-yl) furan-2-carboxylate |
| SMILES | CC.Cc1ccc2c(C)cc(C)c(OC(=O)c3ccco3)c2n1 |
| InChI | InChI=1S/C17H15NO3.C2H6/c1-10-9-11(2)16(15-13(10)7-6-12(3)18-15)21-17(19)14-5-4-8-20-14;1-2/h4-9H,1-3H3;1-2H3 |
| InChIKey | DFCYETQOAJTUJH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|