C28H46O — CID 145161349
ethane;methane;(9R,13R,17R)-13-methyl-17-[(E)-5-methylhex-2-enyl]-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 145161349) has the molecular formula C28H46O and a molecular weight of 398.68 g/mol. Its IUPAC name is ethane;methane;(9R,13R,17R)-13-methyl-17-[(E)-5-methylhex-2-enyl]-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | ethane;methane;(9R,13R,17R)-13-methyl-17-[(E)-5-methylhex-2-enyl]-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145161349 |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | ethane;methane;(9R,13R,17R)-13-methyl-17-[(E)-5-methylhex-2-enyl]-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C.CC.CC(C)C/C=C/C[C@H]1CCC2C3C=CC4=CC(=O)CCC4[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H36O.C2H6.CH4/c1-17(2)6-4-5-7-19-9-13-24-23-11-8-18-16-20(26)10-12-21(18)22(23)14-15-25(19,24)3;1-2;/h4-5,8,11,16-17,19,21-24H,6-7,9-10,12-15H2,1-3H3;1-2H3;1H4/b5-4+;;/t19-,21?,22-,23?,24?,25+;;/m0../s1 |
| InChIKey | CNWWVFREMBXWKG-CECHYGDWSA-N |
| XLogP | 8.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|