C20H29F — CID 22795546
(8R,9S,10R,13R,14S,17R)-17-(2-fluoroethyl)-13-methyl-1,2,3,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 22795546) has the molecular formula C20H29F and a molecular weight of 288.45 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17R)-17-(2-fluoroethyl)-13-methyl-1,2,3,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13R,14S,17R)-17-(2-fluoroethyl)-13-methyl-1,2,3,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22795546 |
| Molecular Formula | C20H29F |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (8R,9S,10R,13R,14S,17R)-17-(2-fluoroethyl)-13-methyl-1,2,3,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC[C@H]3[C@@H](C=CC4=CCCC[C@@H]43)[C@@H]1CC[C@@H]2CCF |
| InChI | InChI=1S/C20H29F/c1-20-12-10-17-16-5-3-2-4-14(16)6-8-18(17)19(20)9-7-15(20)11-13-21/h4,6,8,15-19H,2-3,5,7,9-13H2,1H3/t15-,16+,17-,18-,19+,20-/m1/s1 |
| InChIKey | MOCOGYWZPUGQKC-RKGSWTEASA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |