C20H30O — CID 54283116
(8R,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-5,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-4H-cyclopenta[a]phenanthren-3-one (PubChem CID 54283116) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-5,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-4H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-5,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-4H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54283116 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (8R,9S,10R,13R,14S,17S)-17-ethyl-13-methyl-5,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-4H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4CC(=O)C=C[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H30O/c1-3-14-5-9-19-18-7-4-13-12-15(21)6-8-16(13)17(18)10-11-20(14,19)2/h6,8,13-14,16-19H,3-5,7,9-12H2,1-2H3/t13?,14-,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | RSEJFQBJVVSFHV-STANZVMRSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |