About N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine
N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine (PubChem CID 145162195) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine |
| PubChem CID | 145162195 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine |
| SMILES | CN(Cc1cc#ccc1)c1ccccn1 |
| InChI | InChI=1S/C13H12N2/c1-15(13-9-5-6-10-14-13)11-12-7-3-2-4-8-12/h3,5-10H,11H2,1H3 |
| InChIKey | MALZDBUGVYUZKU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine?
The IUPAC name of N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine (CID 145162195) is N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine.
What is the SMILES notation for N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine?
The canonical SMILES for N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine is CN(Cc1cc#ccc1)c1ccccn1.
What is the InChIKey of N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine?
The InChIKey is MALZDBUGVYUZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-15(13-9-5-6-10-14-13)11-12-7-3-2-4-8-12/h3,5-10H,11H2,1H3.
What are the key properties of N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine?
N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine has a molecular weight of 196.25 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-3-yn-1-ylmethyl)-N-methylpyridin-2-amine is sourced from PubChem (CID 145162195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).