C9H13F3N2O3 — CID 145162891
ethyl (3E)-3-[acetyl(methyl)hydrazinylidene]-4,4,4-trifluorobutanoate (PubChem CID 145162891) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is ethyl (3E)-3-[acetyl(methyl)hydrazinylidene]-4,4,4-trifluorobutanoate.
| Compound Name | ethyl (3E)-3-[acetyl(methyl)hydrazinylidene]-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 145162891 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl (3E)-3-[acetyl(methyl)hydrazinylidene]-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C/C(=N\N(C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3/c1-4-17-8(16)5-7(9(10,11)12)13-14(3)6(2)15/h4-5H2,1-3H3/b13-7+ |
| InChIKey | LNBVWYLHVZXYKD-NTUHNPAUSA-N |
| XLogP | 1.34 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|