C12H10F3IN2O4 — CID 23243985
ethyl 4,4,4-trifluoro-3-(2-iodo-4-nitrophenyl)iminobutanoate (PubChem CID 23243985) has the molecular formula C12H10F3IN2O4 and a molecular weight of 430.12 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-(2-iodo-4-nitrophenyl)iminobutanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-(2-iodo-4-nitrophenyl)iminobutanoate |
|---|---|
| PubChem CID | 23243985 |
| Molecular Formula | C12H10F3IN2O4 |
| Molecular Weight | 430.12 g/mol |
| Exact Mass | 429.96 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-(2-iodo-4-nitrophenyl)iminobutanoate |
| SMILES | CCOC(=O)C/C(=N\c1ccc([N+](=O)[O-])cc1I)C(F)(F)F |
| InChI | InChI=1S/C12H10F3IN2O4/c1-2-22-11(19)6-10(12(13,14)15)17-9-4-3-7(18(20)21)5-8(9)16/h3-5H,2,6H2,1H3/b17-10+ |
| InChIKey | LWTYWTRMBRIMTF-LICLKQGHSA-N |
| XLogP | 3.79 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|