C24H47N7 — CID 145163543
2-N-[(Z)-ethylideneamino]-2-N-methyl-4-N,6-N-bis(3-methyloctan-3-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 145163543) has the molecular formula C24H47N7 and a molecular weight of 433.69 g/mol. Its IUPAC name is 2-N-[(Z)-ethylideneamino]-2-N-methyl-4-N,6-N-bis(3-methyloctan-3-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(Z)-ethylideneamino]-2-N-methyl-4-N,6-N-bis(3-methyloctan-3-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 145163543 |
| Molecular Formula | C24H47N7 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.39 |
| IUPAC Name | 2-N-[(Z)-ethylideneamino]-2-N-methyl-4-N,6-N-bis(3-methyloctan-3-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C/C=N\N(C)c1nc(NC(C)(CC)CCCCC)nc(NC(C)(CC)CCCCC)n1 |
| InChI | InChI=1S/C24H47N7/c1-9-14-16-18-23(6,11-3)29-20-26-21(28-22(27-20)31(8)25-13-5)30-24(7,12-4)19-17-15-10-2/h13H,9-12,14-19H2,1-8H3,(H2,26,27,28,29,30)/b25-13- |
| InChIKey | VUHRONQPHGZIPP-MXAYSNPKSA-N |
| XLogP | 6.64 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|