C15H26N2O6S — CID 145163824
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2-methylpropanethioylamino)ethoxy]ethoxy]propanoate;molecular hydrogen (PubChem CID 145163824) has the molecular formula C15H26N2O6S and a molecular weight of 362.45 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2-methylpropanethioylamino)ethoxy]ethoxy]propanoate;molecular hydrogen.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2-methylpropanethioylamino)ethoxy]ethoxy]propanoate;molecular hydrogen |
|---|---|
| PubChem CID | 145163824 |
| Molecular Formula | C15H26N2O6S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2-methylpropanethioylamino)ethoxy]ethoxy]propanoate;molecular hydrogen |
| SMILES | CC(C)C(=S)NCCOCCOCCC(=O)ON1C(=O)CCC1=O.[H][H] |
| InChI | InChI=1S/C15H24N2O6S.H2/c1-11(2)15(24)16-6-8-22-10-9-21-7-5-14(20)23-17-12(18)3-4-13(17)19;/h11H,3-10H2,1-2H3,(H,16,24);1H |
| InChIKey | PPFKWDDQHAYUAZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|