C28H40N6O6S3 — CID 145164860
[N'-[2-[3-(2-hydroxyethoxy)phenyl]acetyl]carbamimidoyl] 3-[3-amino-3-[amino-[[2-[3-(2-hydroxyethoxy)phenyl]acetyl]amino]methyl]sulfanylpropyl]sulfanylpropanimidothioate (PubChem CID 145164860) has the molecular formula C28H40N6O6S3 and a molecular weight of 652.87 g/mol. Its IUPAC name is [N'-[2-[3-(2-hydroxyethoxy)phenyl]acetyl]carbamimidoyl] 3-[3-amino-3-[amino-[[2-[3-(2-hydroxyethoxy)phenyl]acetyl]amino]methyl]sulfanylpropyl]sulfanylpropanimidothioate.
| Compound Name | [N'-[2-[3-(2-hydroxyethoxy)phenyl]acetyl]carbamimidoyl] 3-[3-amino-3-[amino-[[2-[3-(2-hydroxyethoxy)phenyl]acetyl]amino]methyl]sulfanylpropyl]sulfanylpropanimidothioate |
|---|---|
| PubChem CID | 145164860 |
| Molecular Formula | C28H40N6O6S3 |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | [N'-[2-[3-(2-hydroxyethoxy)phenyl]acetyl]carbamimidoyl] 3-[3-amino-3-[amino-[[2-[3-(2-hydroxyethoxy)phenyl]acetyl]amino]methyl]sulfanylpropyl]sulfanylpropanimidothioate |
| SMILES | [H]/N=C(/CCSCCC(N)SC(N)NC(=O)Cc1cccc(OCCO)c1)S/C(N)=N/C(=O)Cc1cccc(OCCO)c1 |
| InChI | InChI=1S/C28H40N6O6S3/c29-23(42-27(31)33-25(37)17-19-3-1-5-21(15-19)39-11-9-35)7-13-41-14-8-24(30)43-28(32)34-26(38)18-20-4-2-6-22(16-20)40-12-10-36/h1-6,15-16,23,27,30,35-36H,7-14,17-18,29,31H2,(H,33,37)(H2,32,34,38)/b30-24- |
| InChIKey | SMXLWYXLESQZOB-KRUMMXJUSA-N |
| XLogP | 1.66 |
| TPSA | 219.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|