About 4-fluorobenzonitrile
4-fluorobenzonitrile (PubChem CID 14517) has the molecular formula C7H4FN
and a molecular weight of 121.11 g/mol. Its IUPAC name is 4-fluorobenzonitrile.
Molecular Properties
| Compound Name | 4-fluorobenzonitrile |
| PubChem CID | 14517 |
| Molecular Formula | C7H4FN |
| Molecular Weight | 121.11 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H4FN/c8-7-3-1-6(5-9)2-4-7/h1-4H |
| InChIKey | AEKVBBNGWBBYLL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.11 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzonitrile?
The IUPAC name of 4-fluorobenzonitrile (CID 14517) is 4-fluorobenzonitrile.
What is the SMILES notation for 4-fluorobenzonitrile?
The canonical SMILES for 4-fluorobenzonitrile is N#Cc1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzonitrile?
The InChIKey is AEKVBBNGWBBYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN/c8-7-3-1-6(5-9)2-4-7/h1-4H.
What are the key properties of 4-fluorobenzonitrile?
4-fluorobenzonitrile has a molecular weight of 121.11 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzonitrile is sourced from PubChem (CID 14517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).