C10H9BrFN — CID 145171235
3-bromo-N-buta-1,3-dien-2-yl-2-fluoroaniline (PubChem CID 145171235) has the molecular formula C10H9BrFN and a molecular weight of 242.09 g/mol. Its IUPAC name is 3-bromo-N-buta-1,3-dien-2-yl-2-fluoroaniline.
| Compound Name | 3-bromo-N-buta-1,3-dien-2-yl-2-fluoroaniline |
|---|---|
| PubChem CID | 145171235 |
| Molecular Formula | C10H9BrFN |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 3-bromo-N-buta-1,3-dien-2-yl-2-fluoroaniline |
| SMILES | C=CC(=C)Nc1cccc(Br)c1F |
| InChI | InChI=1S/C10H9BrFN/c1-3-7(2)13-9-6-4-5-8(11)10(9)12/h3-6,13H,1-2H2 |
| InChIKey | QLIJEWCJRDQSLX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|