C13H14ClFN2O — CID 145173837
(1E)-3-[(3-chloro-5-fluorophenyl)methylideneamino]-2-methoxy-N-methylbuta-1,3-dien-1-amine (PubChem CID 145173837) has the molecular formula C13H14ClFN2O and a molecular weight of 268.72 g/mol. Its IUPAC name is (1E)-3-[(3-chloro-5-fluorophenyl)methylideneamino]-2-methoxy-N-methylbuta-1,3-dien-1-amine.
| Compound Name | (1E)-3-[(3-chloro-5-fluorophenyl)methylideneamino]-2-methoxy-N-methylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145173837 |
| Molecular Formula | C13H14ClFN2O |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (1E)-3-[(3-chloro-5-fluorophenyl)methylideneamino]-2-methoxy-N-methylbuta-1,3-dien-1-amine |
| SMILES | C=C(/N=C/c1cc(F)cc(Cl)c1)/C(=C\NC)OC |
| InChI | InChI=1S/C13H14ClFN2O/c1-9(13(18-3)8-16-2)17-7-10-4-11(14)6-12(15)5-10/h4-8,16H,1H2,2-3H3/b13-8+,17-7+ |
| InChIKey | FGRUXJQUFFQVLN-CYECVDMHSA-N |
| XLogP | 3.12 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|