C12H17N3O2S — CID 145175937
1-(2-oxoethylamino)sulfanyl-3-(1-phenylpropan-2-yl)urea (PubChem CID 145175937) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(2-oxoethylamino)sulfanyl-3-(1-phenylpropan-2-yl)urea.
| Compound Name | 1-(2-oxoethylamino)sulfanyl-3-(1-phenylpropan-2-yl)urea |
|---|---|
| PubChem CID | 145175937 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-(2-oxoethylamino)sulfanyl-3-(1-phenylpropan-2-yl)urea |
| SMILES | CC(Cc1ccccc1)NC(=O)NSNCC=O |
| InChI | InChI=1S/C12H17N3O2S/c1-10(9-11-5-3-2-4-6-11)14-12(17)15-18-13-7-8-16/h2-6,8,10,13H,7,9H2,1H3,(H2,14,15,17) |
| InChIKey | GSULIMPOXYKWKQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|