C17H20N4O2S — CID 145175525
N-[4-[(1-phenylpropan-2-ylcarbamoylamino)sulfanylamino]phenyl]formamide (PubChem CID 145175525) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[4-[(1-phenylpropan-2-ylcarbamoylamino)sulfanylamino]phenyl]formamide.
| Compound Name | N-[4-[(1-phenylpropan-2-ylcarbamoylamino)sulfanylamino]phenyl]formamide |
|---|---|
| PubChem CID | 145175525 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[4-[(1-phenylpropan-2-ylcarbamoylamino)sulfanylamino]phenyl]formamide |
| SMILES | CC(Cc1ccccc1)NC(=O)NSNc1ccc(NC=O)cc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-13(11-14-5-3-2-4-6-14)19-17(23)21-24-20-16-9-7-15(8-10-16)18-12-22/h2-10,12-13,20H,11H2,1H3,(H,18,22)(H2,19,21,23) |
| InChIKey | KCCZVCGNZOOMIX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|