C37H47N5O5S — CID 145176048
4-methoxy-N,N-dimethylaniline;N-(4-methoxyphenyl)-N-methylformamide;1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]sulfanyl-3-(1-phenylpropan-2-yl)urea (PubChem CID 145176048) has the molecular formula C37H47N5O5S and a molecular weight of 673.88 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethylaniline;N-(4-methoxyphenyl)-N-methylformamide;1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]sulfanyl-3-(1-phenylpropan-2-yl)urea.
| Compound Name | 4-methoxy-N,N-dimethylaniline;N-(4-methoxyphenyl)-N-methylformamide;1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]sulfanyl-3-(1-phenylpropan-2-yl)urea |
|---|---|
| PubChem CID | 145176048 |
| Molecular Formula | C37H47N5O5S |
| Molecular Weight | 673.88 g/mol |
| Exact Mass | 673.33 |
| IUPAC Name | 4-methoxy-N,N-dimethylaniline;N-(4-methoxyphenyl)-N-methylformamide;1-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]sulfanyl-3-(1-phenylpropan-2-yl)urea |
| SMILES | CC(Cc1ccccc1)NC(=O)NSN[C@H](C=O)Cc1ccccc1.COc1ccc(N(C)C)cc1.COc1ccc(N(C)C=O)cc1 |
| InChI | InChI=1S/C19H23N3O2S.C9H11NO2.C9H13NO/c1-15(12-16-8-4-2-5-9-16)20-19(24)22-25-21-18(14-23)13-17-10-6-3-7-11-17;1-10(7-11)8-3-5-9(12-2)6-4-8;1-10(2)8-4-6-9(11-3)7-5-8/h2-11,14-15,18,21H,12-13H2,1H3,(H2,20,22,24);3-7H,1-2H3;4-7H,1-3H3/t15?,18-;;/m0../s1 |
| InChIKey | KIUGDBSQXZHGHH-NWDDPRCASA-N |
| XLogP | 5.93 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.88 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|