About [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one
[(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one (PubChem CID 145176263) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one.
Molecular Properties
| Compound Name | [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one |
| PubChem CID | 145176263 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one |
| SMILES | C/C=C\c1ccccc1.CCCNC1CCC(=O)CC1 |
| InChI | InChI=1S/C9H17NO.C9H10/c1-2-7-10-8-3-5-9(11)6-4-8;1-2-6-9-7-4-3-5-8-9/h8,10H,2-7H2,1H3;2-8H,1H3/b;6-2- |
| InChIKey | RKBDVYMEQQZVBE-MKSBNHLASA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one?
The IUPAC name of [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one (CID 145176263) is [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one.
What is the SMILES notation for [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one?
The canonical SMILES for [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one is C/C=C\c1ccccc1.CCCNC1CCC(=O)CC1.
What is the InChIKey of [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one?
The InChIKey is RKBDVYMEQQZVBE-MKSBNHLASA-N. The full InChI is InChI=1S/C9H17NO.C9H10/c1-2-7-10-8-3-5-9(11)6-4-8;1-2-6-9-7-4-3-5-8-9/h8,10H,2-7H2,1H3;2-8H,1H3/b;6-2-.
What are the key properties of [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one?
[(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one has a molecular weight of 273.42 g/mol, XLogP of 4.22, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-prop-1-enyl]benzene;4-(propylamino)cyclohexan-1-one is sourced from PubChem (CID 145176263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).