C21H36N2O2 — CID 145176296
2-aminoacetic acid;[(Z)-but-1-enyl]benzene;N-propylcyclohexanamine (PubChem CID 145176296) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 2-aminoacetic acid;[(Z)-but-1-enyl]benzene;N-propylcyclohexanamine.
| Compound Name | 2-aminoacetic acid;[(Z)-but-1-enyl]benzene;N-propylcyclohexanamine |
|---|---|
| PubChem CID | 145176296 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 2-aminoacetic acid;[(Z)-but-1-enyl]benzene;N-propylcyclohexanamine |
| SMILES | CC/C=C\c1ccccc1.CCCNC1CCCCC1.NCC(=O)O |
| InChI | InChI=1S/C10H12.C9H19N.C2H5NO2/c1-2-3-7-10-8-5-4-6-9-10;1-2-8-10-9-6-4-3-5-7-9;3-1-2(4)5/h3-9H,2H2,1H3;9-10H,2-8H2,1H3;1,3H2,(H,4,5)/b7-3-;; |
| InChIKey | ZMYGKTAXQAOYMJ-NAMRTZQUSA-N |
| XLogP | 4.46 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |