C26H27N5O2 — CID 145183248
(3S)-2-(5-amino-2-pyridinyl)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one (PubChem CID 145183248) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is (3S)-2-(5-amino-2-pyridinyl)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one.
| Compound Name | (3S)-2-(5-amino-2-pyridinyl)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 145183248 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (3S)-2-(5-amino-2-pyridinyl)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one |
| SMILES | Cc1ccc(N2CCN(C(=O)C[C@H]3c4ccccc4C(=O)N3c3ccc(N)cn3)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O2/c1-18-6-9-20(10-7-18)29-12-14-30(15-13-29)25(32)16-23-21-4-2-3-5-22(21)26(33)31(23)24-11-8-19(27)17-28-24/h2-11,17,23H,12-16,27H2,1H3/t23-/m0/s1 |
| InChIKey | KFZGXBYVNLCTGG-QHCPKHFHSA-N |
| XLogP | 3.41 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|