C21H23N3O3 — CID 7677868
(3R)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one (PubChem CID 7677868) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3R)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one.
| Compound Name | (3R)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 7677868 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (3R)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)C[C@H]3NC(=O)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-27-16-8-6-15(7-9-16)23-10-12-24(13-11-23)20(25)14-19-17-4-2-3-5-18(17)21(26)22-19/h2-9,19H,10-14H2,1H3,(H,22,26)/t19-/m1/s1 |
| InChIKey | QKVAWLUVSLSISH-LJQANCHMSA-N |
| XLogP | 2.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|