C21H23N3O2 — CID 154843739
2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-(1-phenylpiperidin-4-yl)acetamide (PubChem CID 154843739) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-(1-phenylpiperidin-4-yl)acetamide.
| Compound Name | 2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-(1-phenylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 154843739 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-(3-oxo-1,2-dihydroisoindol-1-yl)-N-(1-phenylpiperidin-4-yl)acetamide |
| SMILES | O=C(CC1NC(=O)c2ccccc21)NC1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3O2/c25-20(14-19-17-8-4-5-9-18(17)21(26)23-19)22-15-10-12-24(13-11-15)16-6-2-1-3-7-16/h1-9,15,19H,10-14H2,(H,22,25)(H,23,26) |
| InChIKey | RBBYIRYIPXGTDK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |