C16H21ClN2O3S — CID 145184497
(3S)-1-(5-chloro-2-methoxybenzoyl)-N-(1-sulfanylethyl)piperidine-3-carboxamide (PubChem CID 145184497) has the molecular formula C16H21ClN2O3S and a molecular weight of 356.88 g/mol. Its IUPAC name is (3S)-1-(5-chloro-2-methoxybenzoyl)-N-(1-sulfanylethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(5-chloro-2-methoxybenzoyl)-N-(1-sulfanylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 145184497 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (3S)-1-(5-chloro-2-methoxybenzoyl)-N-(1-sulfanylethyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC[C@H](C(=O)NC(C)S)C1 |
| InChI | InChI=1S/C16H21ClN2O3S/c1-10(23)18-15(20)11-4-3-7-19(9-11)16(21)13-8-12(17)5-6-14(13)22-2/h5-6,8,10-11,23H,3-4,7,9H2,1-2H3,(H,18,20)/t10?,11-/m0/s1 |
| InChIKey | AOUUYEZDQYKFRT-DTIOYNMSSA-N |
| XLogP | 2.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|