C24H27ClN2O3S — CID 153353803
1-(5-chloro-2-methoxybenzoyl)-N-[(E)-4-phenylsulfanylbut-3-enyl]piperidine-3-carboxamide (PubChem CID 153353803) has the molecular formula C24H27ClN2O3S and a molecular weight of 459.01 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxybenzoyl)-N-[(E)-4-phenylsulfanylbut-3-enyl]piperidine-3-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxybenzoyl)-N-[(E)-4-phenylsulfanylbut-3-enyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 153353803 |
| Molecular Formula | C24H27ClN2O3S |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-(5-chloro-2-methoxybenzoyl)-N-[(E)-4-phenylsulfanylbut-3-enyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCCC(C(=O)NCC/C=C/Sc2ccccc2)C1 |
| InChI | InChI=1S/C24H27ClN2O3S/c1-30-22-12-11-19(25)16-21(22)24(29)27-14-7-8-18(17-27)23(28)26-13-5-6-15-31-20-9-3-2-4-10-20/h2-4,6,9-12,15-16,18H,5,7-8,13-14,17H2,1H3,(H,26,28)/b15-6+ |
| InChIKey | HPBUMPIIODBHDR-GIDUJCDVSA-N |
| XLogP | 5.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|