C27H33NO4 — CID 145184606
ethyl (2R,4S)-5-[(1E,6Z)-5-cyclohepta-2,4,6-trien-1-ylcycloocta-1,4,6-trien-1-yl]-4-(2,5-dioxopyrrolidin-1-yl)-2-methylpentanoate (PubChem CID 145184606) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is ethyl (2R,4S)-5-[(1E,6Z)-5-cyclohepta-2,4,6-trien-1-ylcycloocta-1,4,6-trien-1-yl]-4-(2,5-dioxopyrrolidin-1-yl)-2-methylpentanoate.
| Compound Name | ethyl (2R,4S)-5-[(1E,6Z)-5-cyclohepta-2,4,6-trien-1-ylcycloocta-1,4,6-trien-1-yl]-4-(2,5-dioxopyrrolidin-1-yl)-2-methylpentanoate |
|---|---|
| PubChem CID | 145184606 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | ethyl (2R,4S)-5-[(1E,6Z)-5-cyclohepta-2,4,6-trien-1-ylcycloocta-1,4,6-trien-1-yl]-4-(2,5-dioxopyrrolidin-1-yl)-2-methylpentanoate |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](C/C1=C/CC=C(C2C=CC=CC=C2)/C=C\C1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C27H33NO4/c1-3-32-27(31)20(2)18-24(28-25(29)16-17-26(28)30)19-21-10-8-14-23(15-9-11-21)22-12-6-4-5-7-13-22/h4-8,11-15,20,22,24H,3,9-10,16-19H2,1-2H3/b14-8-,21-11+,23-15?/t20-,24+/m1/s1 |
| InChIKey | UFEJNJQCNFANBZ-KLRZHIMCSA-N |
| XLogP | 4.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|