C19H25FO2 — CID 145191840
1-[5-[4-(4-fluorophenyl)cyclohexyl]oxan-2-yl]ethanone (PubChem CID 145191840) has the molecular formula C19H25FO2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-[5-[4-(4-fluorophenyl)cyclohexyl]oxan-2-yl]ethanone.
| Compound Name | 1-[5-[4-(4-fluorophenyl)cyclohexyl]oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 145191840 |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[5-[4-(4-fluorophenyl)cyclohexyl]oxan-2-yl]ethanone |
| SMILES | CC(=O)C1CCC(C2CCC(c3ccc(F)cc3)CC2)CO1 |
| InChI | InChI=1S/C19H25FO2/c1-13(21)19-11-8-17(12-22-19)16-4-2-14(3-5-16)15-6-9-18(20)10-7-15/h6-7,9-10,14,16-17,19H,2-5,8,11-12H2,1H3 |
| InChIKey | UBDDPCMFDGXCTF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |