C22H32F2O2 — CID 164676063
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-difluoro-6-phenylhexanoate (PubChem CID 164676063) has the molecular formula C22H32F2O2 and a molecular weight of 366.49 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-difluoro-6-phenylhexanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-difluoro-6-phenylhexanoate |
|---|---|
| PubChem CID | 164676063 |
| Molecular Formula | C22H32F2O2 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,2-difluoro-6-phenylhexanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C(F)(F)CCCCc1ccccc1 |
| InChI | InChI=1S/C22H32F2O2/c1-16(2)19-13-12-17(3)15-20(19)26-21(25)22(23,24)14-8-7-11-18-9-5-4-6-10-18/h4-6,9-10,16-17,19-20H,7-8,11-15H2,1-3H3/t17-,19+,20-/m1/s1 |
| InChIKey | SMLDODBXKRKYMR-YZGWKJHDSA-N |
| XLogP | 6.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|