About ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate
ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate (PubChem CID 10684606) has the molecular formula C17H15FO3
and a molecular weight of 286.30 g/mol. Its IUPAC name is ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate |
| PubChem CID | 10684606 |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate |
| SMILES | CCOC(=O)C(=O)C(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15FO3/c1-2-21-16(20)15(19)17(18,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | KBBSAVZAPASQEA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate?
The IUPAC name of ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate (CID 10684606) is ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate.
What is the SMILES notation for ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate?
The canonical SMILES for ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate is CCOC(=O)C(=O)C(F)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate?
The InChIKey is KBBSAVZAPASQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FO3/c1-2-21-16(20)15(19)17(18,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3.
What are the key properties of ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate?
ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate has a molecular weight of 286.30 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-fluoro-2-oxo-3,3-diphenylpropanoate is sourced from PubChem (CID 10684606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).