C15H21FO2 — CID 145191863
2-fluoro-5-[(4S)-3-methylheptan-4-yl]benzoic acid (PubChem CID 145191863) has the molecular formula C15H21FO2 and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-fluoro-5-[(4S)-3-methylheptan-4-yl]benzoic acid.
| Compound Name | 2-fluoro-5-[(4S)-3-methylheptan-4-yl]benzoic acid |
|---|---|
| PubChem CID | 145191863 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-fluoro-5-[(4S)-3-methylheptan-4-yl]benzoic acid |
| SMILES | CCC[C@H](c1ccc(F)c(C(=O)O)c1)C(C)CC |
| InChI | InChI=1S/C15H21FO2/c1-4-6-12(10(3)5-2)11-7-8-14(16)13(9-11)15(17)18/h7-10,12H,4-6H2,1-3H3,(H,17,18)/t10?,12-/m0/s1 |
| InChIKey | CNEJLCRAMYRAMM-KFJBMODSSA-N |
| XLogP | 4.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |