C28H27N5O2 — CID 145192856
2-[3-(4-amino-3-ethanimidoylphenyl)-5-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]benzamide (PubChem CID 145192856) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 2-[3-(4-amino-3-ethanimidoylphenyl)-5-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]benzamide.
| Compound Name | 2-[3-(4-amino-3-ethanimidoylphenyl)-5-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 145192856 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-[3-(4-amino-3-ethanimidoylphenyl)-5-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]benzamide |
| SMILES | [H]/N=C(\C)c1cc(-c2cc(NC(CO)c3ccccc3)cnc2-c2ccccc2C(N)=O)ccc1N |
| InChI | InChI=1S/C28H27N5O2/c1-17(29)23-13-19(11-12-25(23)30)24-14-20(33-26(16-34)18-7-3-2-4-8-18)15-32-27(24)21-9-5-6-10-22(21)28(31)35/h2-15,26,29,33-34H,16,30H2,1H3,(H2,31,35)/b29-17+ |
| InChIKey | PGQOYXKJHPYAEM-STBIYBPSSA-N |
| XLogP | 4.63 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|