C28H24F4N4O — CID 145192838
2-[[5-(4-amino-3-ethanimidoylphenyl)-6-[4-fluoro-2-(trifluoromethyl)phenyl]-3-pyridinyl]amino]-2-phenylethanol (PubChem CID 145192838) has the molecular formula C28H24F4N4O and a molecular weight of 508.52 g/mol. Its IUPAC name is 2-[[5-(4-amino-3-ethanimidoylphenyl)-6-[4-fluoro-2-(trifluoromethyl)phenyl]-3-pyridinyl]amino]-2-phenylethanol.
| Compound Name | 2-[[5-(4-amino-3-ethanimidoylphenyl)-6-[4-fluoro-2-(trifluoromethyl)phenyl]-3-pyridinyl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 145192838 |
| Molecular Formula | C28H24F4N4O |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2-[[5-(4-amino-3-ethanimidoylphenyl)-6-[4-fluoro-2-(trifluoromethyl)phenyl]-3-pyridinyl]amino]-2-phenylethanol |
| SMILES | [H]/N=C(\C)c1cc(-c2cc(NC(CO)c3ccccc3)cnc2-c2ccc(F)cc2C(F)(F)F)ccc1N |
| InChI | InChI=1S/C28H24F4N4O/c1-16(33)22-11-18(7-10-25(22)34)23-13-20(36-26(15-37)17-5-3-2-4-6-17)14-35-27(23)21-9-8-19(29)12-24(21)28(30,31)32/h2-14,26,33,36-37H,15,34H2,1H3/b33-16+ |
| InChIKey | PLGVDXSTHNDDKJ-MHDJOFBISA-N |
| XLogP | 6.69 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|