C12H17NO — CID 145194841
2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)prop-2-enenitrile (PubChem CID 145194841) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)prop-2-enenitrile.
| Compound Name | 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 145194841 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-(1-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl)prop-2-enenitrile |
| SMILES | C=C(C#N)C1(O)C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C12H17NO/c1-9-5-11(3,4)8-12(14,6-9)10(2)7-13/h6,14H,2,5,8H2,1,3-4H3 |
| InChIKey | WPHCJSTXCFTLCS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|