C21H28BrN3O3 — CID 145196962
tert-butyl 3-[2-(3-bromophenyl)propanoylamino]-5-butan-2-ylpyrazole-1-carboxylate (PubChem CID 145196962) has the molecular formula C21H28BrN3O3 and a molecular weight of 450.38 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-bromophenyl)propanoylamino]-5-butan-2-ylpyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(3-bromophenyl)propanoylamino]-5-butan-2-ylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 145196962 |
| Molecular Formula | C21H28BrN3O3 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | tert-butyl 3-[2-(3-bromophenyl)propanoylamino]-5-butan-2-ylpyrazole-1-carboxylate |
| SMILES | CCC(C)c1cc(NC(=O)C(C)c2cccc(Br)c2)nn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28BrN3O3/c1-7-13(2)17-12-18(24-25(17)20(27)28-21(4,5)6)23-19(26)14(3)15-9-8-10-16(22)11-15/h8-14H,7H2,1-6H3,(H,23,24,26) |
| InChIKey | DPMJHYUXTFGKNY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |