C15H27N3O — CID 145197752
ethane;4-[2-methyl-3-[(2Z)-penta-2,4-dien-2-yl]iminopropyl]piperazin-2-one (PubChem CID 145197752) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is ethane;4-[2-methyl-3-[(2Z)-penta-2,4-dien-2-yl]iminopropyl]piperazin-2-one.
| Compound Name | ethane;4-[2-methyl-3-[(2Z)-penta-2,4-dien-2-yl]iminopropyl]piperazin-2-one |
|---|---|
| PubChem CID | 145197752 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | ethane;4-[2-methyl-3-[(2Z)-penta-2,4-dien-2-yl]iminopropyl]piperazin-2-one |
| SMILES | C=C/C=C(C)\N=C\C(C)CN1CCNC(=O)C1.CC |
| InChI | InChI=1S/C13H21N3O.C2H6/c1-4-5-12(3)15-8-11(2)9-16-7-6-14-13(17)10-16;1-2/h4-5,8,11H,1,6-7,9-10H2,2-3H3,(H,14,17);1-2H3/b12-5-,15-8+; |
| InChIKey | UYDIDUBQYGPZDJ-FVWXEACDSA-N |
| XLogP | 2.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|