C15H27N3O — CID 145198420
1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]-3,3-dimethylpiperazin-2-one;ethane (PubChem CID 145198420) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]-3,3-dimethylpiperazin-2-one;ethane.
| Compound Name | 1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]-3,3-dimethylpiperazin-2-one;ethane |
|---|---|
| PubChem CID | 145198420 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 1-[3-[(Z)-but-2-en-2-yl]iminoprop-1-en-2-yl]-3,3-dimethylpiperazin-2-one;ethane |
| SMILES | C=C(/C=N/C(C)=C\C)N1CCNC(C)(C)C1=O.CC |
| InChI | InChI=1S/C13H21N3O.C2H6/c1-6-10(2)14-9-11(3)16-8-7-15-13(4,5)12(16)17;1-2/h6,9,15H,3,7-8H2,1-2,4-5H3;1-2H3/b10-6-,14-9+; |
| InChIKey | XCAGDVNBVJPFJP-DSVGSESYSA-N |
| XLogP | 2.73 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|