C13H23N3O — CID 145197758
ethane;4-[2-(prop-1-en-2-yliminomethyl)prop-2-enyl]piperazin-2-one (PubChem CID 145197758) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is ethane;4-[2-(prop-1-en-2-yliminomethyl)prop-2-enyl]piperazin-2-one.
| Compound Name | ethane;4-[2-(prop-1-en-2-yliminomethyl)prop-2-enyl]piperazin-2-one |
|---|---|
| PubChem CID | 145197758 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | ethane;4-[2-(prop-1-en-2-yliminomethyl)prop-2-enyl]piperazin-2-one |
| SMILES | C=C(/C=N/C(=C)C)CN1CCNC(=O)C1.CC |
| InChI | InChI=1S/C11H17N3O.C2H6/c1-9(2)13-6-10(3)7-14-5-4-12-11(15)8-14;1-2/h6H,1,3-5,7-8H2,2H3,(H,12,15);1-2H3/b13-6+; |
| InChIKey | IJWLKBRSJCPSGE-AWFSDRIXSA-N |
| XLogP | 1.61 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|